| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
111-20-6 |
| EC NO: |
203-845-5 |
| Molecular Formula: |
C10H18O4 |
| Molecular Weight: |
202.25052 |
| Specification: |
|
| InChI: |
InChI=1/C10H18O4/c11-9(12)7-5-3-1-2-4-6-8-10(13)14/h1-8H2,(H,11,12)(H,13,14)/p-2 |
Product description:
Raw material in the production of synthetic resins of the alkylated or polyester type, non-migrating plasticizers, polyester rubbers, synthetic fibers of the polyamide type. |
| Synonyms: |
1,8-Octanedicarboxylic acid;Decanedioic acid;Octane-1,8-dicarboxylic acid;decanedioate; |
| Molecular Structure: |
 |