Details for Chloromethyl isopropyl carbonate

Chloromethyl isopropyl carbonate
| Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
35180-01-9 |
| EC NO: |
|
| Molecular Formula: |
C5H9ClO3 |
| Molecular Weight: |
152.5762 |
| Specification: |
|
| InChI: |
InChI=1/C5H9ClO3/c1-4(2)9-5(7)8-3-6/h4H,3H2,1-2H3 |
| Synonyms: |
i-Propyl Chloromethyl Carbonate;Chloromethyl-2-propyl Carbonate;CMIC,for Tenofovir;chloromethyl propan-2-yl carbonate;Chloromethyl propyl carbonate; |
| Molecular Structure: |
 |
if you are sourcing Chloromethyl isopropyl carbonate from Belgium ,just feel free to inquire