Details for Methyl phenylacetate

Methyl phenylacetate
| Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
101-41-7 |
| EC NO: |
202-940-9 |
| Molecular Formula: |
C9H10O2 |
| Molecular Weight: |
150.1745 |
| Specification: |
|
| InChI: |
InChI=1/C9H10O2/c1-11-9(10)7-8-5-3-2-4-6-8/h2-6H,7H2,1H3 |
| Synonyms: |
Methyl phenylacetate/Phenylacetic acid methyl ester;2,5-Bis-(2,2,2-Trifluoroethoxy) Benzoic Acid;Phenylacetic Acid Phenylacetate;Phenylacetic acid methyl ester;Methyl alpha-toluate; |
| Molecular Structure: |
 |
if you are sourcing Methyl phenylacetate from Belgium ,just feel free to inquire