Details for 2,6-Dichlorophenylacetic Acid

2,6-Dichlorophenylacetic Acid
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
6575-24-2 |
| EC NO: |
229-504-0 |
| Molecular Formula: |
C8H6Cl2O2 |
| Molecular Weight: |
205.039 |
| Specification: |
|
| InChI: |
InChI=1/C8H6Cl2O2/c9-6-2-1-3-7(10)5(6)4-8(11)12/h1-3H,4H2,(H,11,12)/p-1 |
Product description:
White solid. |
| Synonyms: |
RARECHEM AL BO 0115;TIMTEC-BB SBB003503;2,6-Dichlorophenyl Acetic Acid; |
| Molecular Structure: |
 |
if you are sourcing 2,6-Dichlorophenylacetic Acid from Belgium ,just feel free to inquire