Details for 4-Chlorobenzeneacetyl chloride

4-Chlorobenzeneacetyl chloride
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
25026-34-0 |
| EC NO: |
246-571-1 |
| Molecular Formula: |
C8H6Cl2O |
| Molecular Weight: |
189.0386 |
| Specification: |
|
| InChI: |
InChI=1/C8H6Cl2O/c9-7-3-1-6(2-4-7)5-8(10)11/h1-4H,5H2 |
| Synonyms: |
4-Chlorophenylacetylchloride;4-CHLOROPHENYLACETYL CHLORIDE;TIMTEC-BB SBB005859;P-CHLOROPHENYLACETYL CHLORIDE;Benzeneacetyl chloride, 4-chloro-;4-Chlorophenylacetyl chloride, extra pure, 96%; |
| Molecular Structure: |
 |
if you are sourcing 4-Chlorobenzeneacetyl chloride from Belgium ,just feel free to inquire