Details for Phenylephrine HCl

Phenylephrine HCl
| Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
61-76-7 |
| EC NO: |
200-517-3 |
| Molecular Formula: |
C9H15Cl2NO2 |
| Molecular Weight: |
240.1269 |
| Specification: |
|
| InChI: |
InChI=1/C9H13NO2.2ClH/c1-10-6-9(12)7-3-2-4-8(11)5-7;;/h2-5,9-12H,6H2,1H3;2*1H/t9-;;/m0../s1 |
| Synonyms: |
3-Hydroxy-alpha-(methylaminomethyl)benzyl alcohol hydrochloride;L-Phenylephrine hydrochloride;(R)-3-Hydroxy-alpha-(methylaminomethyl)benzyl alcohol hydrochloride;Phenylephrine HCL;PHENYLEPHRINE HYDROCHLORIDE;(R)-(-)-1-(3-Hydroxyphenyl)-2-methylaminoethanol hydrochloride;d-(-)-phenylephrinehydrochloride;Phenylephrine Hydrochloride; |
| Molecular Structure: |
 |
if you are sourcing Phenylephrine HCl from Canada ,just feel free to inquire