Details for L-Cysteine HCL Anhydrous

 
L-Cysteine HCL Anhydrous
 
      
        | Category: | 
        Food and Feed additives/Food additives | 
        
        	 | 
      
      
        | CAS NO: | 
      52-89-1   | 
      
      
        | EC NO: | 
        
        200-157-7 | 
      
      
        | Molecular Formula: | 
        
        C3H7ClNO2S | 
      
					
					  | Molecular Weight: | 
                      156.6117 | 
					
                    
                      | Specification: | 
                      	 | 
                    
                    
                      | InChI: | 
                      InChI=1/C3H7NO2S.ClH/c4-2(1-7)3(5)6;/h2,7H,1,4H2,(H,5,6);1H/p-1 | 
                    
                    
                    
                    
                    
                    
                      | Synonyms: | 
                      
                      L-Cysteine hydrochloride;L-cysteine hcl cell culture tested;H-Cys-OH.HCl;L-Cysteine Hcl Anhydrous;L-Cysteine HCl;Di-isopropyl nahpthalene;L-cysteine hydrochloride (1:1);L-Cysteine HCl anhydrate;cysteine, chloride (1:1);2-(2-Methoxy Ethoxy) Acetaldehyde Dimethyl Actal;L-Cysteine monohydrochloride; | 
                    
					
                      | Molecular Structure: | 
                      
                        | 
                    
                  
 
 
 
 
if you are sourcing  L-Cysteine HCL Anhydrous from  Canada ,just feel free to inquire