Details for PGMEA

PGMEA
| Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
84540-57-8 |
| EC NO: |
283-152-2 |
| Molecular Formula: |
C6H12O3 |
| Molecular Weight: |
132.1578 |
| Specification: |
|
| InChI: |
InChI=1/C5H10O3.C3H6/c1-5(6)8-4-3-7-2;1-3-2/h3-4H2,1-2H3;3H,1H2,2H3 |
| Synonyms: |
1-methoxy-2-acetoxypropane;1-methoxy-2-propanol acetate;1-methoxy-2-propyl acetate;(2-(1-methoxy)propyl) acetate;2-acetoxy-1-methoxypropane;2-methoxy-1-methylethyl acetate;pgmea;propylene glycol monomethyl ether acetate;propylene glycol 1-methyl ether 2-acetate;propylene glycol 1-monomethyl ether 2-acetate;pma-el;2-(methoxy)propyl acetate;2-(1-methoxy)propyl acetate;methoxy propanol acetate;1-methoxypropan-2-yl acetate;1-methoxypropyl acetate;(1S)-2-methoxy-1-methylethyl acetate;(1R)-2-methoxy-1-methylethyl acetate;(acetato-kappaO)(phenyl)mercury;Methoxy propyl acetate;GLYCOL ETHER PMA; |
| Molecular Structure: |
 |
if you are sourcing PGMEA from Canada ,just feel free to inquire