Details for 2-Methylthio benzoic acid

2-Methylthio benzoic acid
Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
3724-10-5 |
EC NO: |
|
Molecular Formula: |
C8H7O2S |
Molecular Weight: |
167.2055 |
Specification: |
|
InChI: |
InChI=1/C8H8O2S/c1-11-7-5-3-2-4-6(7)8(9)10/h2-5H,1H3,(H,9,10)/p-1 |
Synonyms: |
Benzoic acid, o-(methylthio)-;2-Carboxyphenyl methyl sulfide;2-Methylmercaptobenzoic acid;4-10-00-00273 (Beilstein Handbook Reference);Acide methyl-S-2-benzoique;Acide methyl-S-2-benzoique [French];BRN 0972385;Benzoic acid, 2-(methylthio)-;NSC 104019;NSC 145347;NSC 151478;NSC 218090;NSC 221934;o-(Methylthio)benzoic acid;Benzoic acid, 2-(methylthio)- (9CI);2-(methylsulfanyl)benzoic acid;2-(methylsulfanyl)benzoate;2-Methylthiobenzoic acid; |
Molecular Structure: |
 |
if you are sourcing 2-Methylthio benzoic acid from China ,just feel free to inquire