Details for 9-phenanthrenylboronic acid

9-phenanthrenylboronic acid
| Category: |
Intermediates |
|
| CAS NO: |
68572-87-2 |
| EC NO: |
|
| Molecular Formula: |
C14H11BO2 |
| Molecular Weight: |
222.0469 |
| Specification: |
|
| InChI: |
InChI=1/C14H11BO2/c16-15(17)14-9-10-5-1-2-6-11(10)12-7-3-4-8-13(12)14/h1-9,16-17H |
| Synonyms: |
9-Phenanthreneboronic acid (contains varying amounts of anhydride);Phenanthrene-9-boronic acid;9-Phenanthracenylboronic acid;phenanthren-9-ylboronic acid;9-phenanthrenylboronic acid;9-Phenanthreneboronic Acid;9-Phenanthrene boronic acid; |
| Molecular Structure: |
 |
if you are sourcing 9-phenanthrenylboronic acid from China ,just feel free to inquire