Details for Dimethyl acetylenedicarboxylate

Dimethyl acetylenedicarboxylate
| Category: |
Intermediates |
|
| CAS NO: |
762-42-5 |
| EC NO: |
212-098-4 |
| Molecular Formula: |
C6H6O4 |
| Molecular Weight: |
142.1094 |
| Specification: |
|
| InChI: |
InChI=1/C6H6O4/c1-9-5(7)3-4-6(8)10-2/h1-2H3 |
| Synonyms: |
DMAD;dimethyl butynedioate;Acetylenedicarboxylic acid dimethyl ester;Butynedioic acid dimethyl ester;DMAD;Dimethyl acetylenedicarboxylate (DMADC);dimethyl but-2-ynedioate;Dimethylaceylene dicarboxylate; |
| Molecular Structure: |
 |
if you are sourcing Dimethyl acetylenedicarboxylate from China ,just feel free to inquire