Details for methyl 4-fluoro-2-hydroxybenzoate

methyl 4-fluoro-2-hydroxybenzoate
| Category: |
Intermediates |
|
| CAS NO: |
392-04-1 |
| EC NO: |
|
| Molecular Formula: |
C8H7FO3 |
| Molecular Weight: |
170.1378 |
| Specification: |
|
| InChI: |
InChI=1/C8H7FO3/c1-12-8(11)6-3-2-5(9)4-7(6)10/h2-4,10H,1H3 |
| Synonyms: |
Methyl 4-fluorosalicylate;4-Fluorosalicylic acid methyl ester;Methyl 4-fluoro-2-hydroxybenzoate;4-Fluoro-6-hydroxy-benzoic acid methyl ester; |
| Molecular Structure: |
 |
if you are sourcing methyl 4-fluoro-2-hydroxybenzoate from China ,just feel free to inquire