Details for 4-Nitrophenyl chloroformate

4-Nitrophenyl chloroformate
Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
7693-46-1 |
EC NO: |
231-706-9 |
Molecular Formula: |
C7H4ClNO4 |
Molecular Weight: |
201.564 |
Specification: |
|
InChI: |
InChI=1/C7H4ClNO4/c8-7(10)13-6-3-1-5(2-4-6)9(11)12/h1-4H |
Synonyms: |
Chloroformic acid 4-nitrophenyl ester;4-nitrophenylchloroformate;4-Nitrophenyl chloridocarbonate;Formic acid, chloro-, p-nitrophenyl ester;p-Nitrophenoxycarbonyl chloride;carbonochloridic acid, 4-nitrophenyl ester;Chloroformic acid P-nitrophenyl ester;4-nitrophenyl chlorocarbonate;4-nitrophenyl carbonochloridate; |
Molecular Structure: |
 |
if you are sourcing 4-Nitrophenyl chloroformate from China ,just feel free to inquire