| Category: | 
        Pharmaceuticals and Biochemicals | 
        
        	 | 
      
      
        | CAS NO: | 
      177325-13-2   | 
      
      
        | EC NO: | 
        
         | 
      
      
        | Molecular Formula: | 
        
        C18H20FN3O4·HCl | 
      
					
					  | Molecular Weight: | 
                      397.8284 | 
					
                    
                      | Specification: | 
                      In accordance with Q/DYYH3012-2001.	 | 
                    
                    
                      | InChI: | 
                      InChI=1/C18H20FN3O4.ClH/c1-10-9-26-17-14-11(16(23)12(18(24)25)8-22(10)14)7-13(19)15(17)21-5-3-20(2)4-6-21;/h7-8,10H,3-6,9H2,1-2H3,(H,24,25);1H/t10-;/m0./s1 | 
                    
                    
                      | Packing: | 
                      25kg per barrel. The barrel is made of paper with two layers of plastic coating. | 
                    
                    
                      Product description: 
                      
                  
                    | CHEMICAL NAME:  | 
                     (-)-9-Fluoro-3-methyl-10-(4-methyl-1-pipera-zinyl)-7-oxo-2,3-dihydro-7H-pyrido[1,2,3-de][1,4]benzo-
 xazine-6-carboxylic acid,Hydrochloride | 
                   
                  
                    | STRUCTURE FORMULAR:  | 
                      | 
                   
                  
                    | MOLECULAR FORMULAR:  | 
                     
C18H20FN3O4HCL  | 
                   
                  
                    | MOLECULAR WEIGHT: | 
                     397.94 | 
                   
                  
                    | STORAGE: | 
                     Should take precautions against heat and moisture. | 
                   
                  | 
                    
                    
                      | Uses: | 
                      
                      The product is completely synthesized antibiotics used for the treatment of diseases caused by various infections. | 
                    
                    
                    
                      | Synonyms: | 
                      
                      LEVOFLOXACIN HCL;carboxylic acid monohydrochloride;LevofloxacinHydrochloride;(3S)-9-fluoro-3-methyl-10-(4-methylpiperazin-1-yl)-7-oxo-2,3-dihydro-7H-[1,4]oxazino[2,3,4-ij]quinoline-6-carboxylic acid hydrochloride;(3S)-9-Fluoro-2,3-dihydro-3-methyl-10-(4-methyl-1-piperazinyl)-7-oxo-7H-pyrido[1,2,3-de]-1,4-benzoxazine-6-carboxylic acid monohydrochloride; | 
                    
					
                      | Molecular Structure: | 
                      
                        |