| Category: |
Intermediates/Pharmaceutical intermediates |
|
| CAS NO: |
83-13-6 |
| EC NO: |
201-456-5 |
| Molecular Formula: |
C13H16O4 |
| Molecular Weight: |
236.2637 |
| Specification: |
|
| InChI: |
InChI=1/C13H16O4/c1-3-16-12(14)11(13(15)17-4-2)10-8-6-5-7-9-10/h5-9,11H,3-4H2,1-2H3 |
| Packing: |
200kg/galvanized iron drum |
Product description:
Diethyl phenylmalonate |
|
83-13-6 |
|
Diethyl phenylmalonate |
|
 |
|
C13H16O |
|
236.0 |
|
Colorless to slightly yellow transparent oil liquid |
|
≥98.5% |
|
≤0.2% |
|
Q/321283GRC08-2003 |
|
Intermediate of pharmaceuticals |
|
200kg/galvanized iron drum |
| |
|
| Usage: |
Intermediate of pharmaceuticals |
| Synonyms: |
Phenylmalonic acid diethyl ester;Phenylpropanedioic acid diethyl ester;phenyl diethyl malonate;Diethyl phenyl malonate;
;diethyl phenylpropanedioate; |
| Molecular Structure: |
 |
CN
China Suppliers > taixingpharm > 
Search Product