Category: |
Others |
|
CAS NO: |
108-31-6 |
EC NO: |
203-571-6 |
Molecular Formula: |
C4H2O3 |
Molecular Weight: |
98.05808 |
Specification: |
99.5% MIN |
InChI: |
InChI=1S/C4H2O3/c5-3-1-2-4(6)7-3/h1-2H |
Packing: |
25kg bag; 25mts loaded in 20' FCL without pallets |
Uses: |
It is mainly used as raw material for the production of unsaturated polyester resin, alkyd resin, pesticide Malathion, high efficiency and low toxicity pesticide 4049, long-acting iodamide, etc. |
Synonyms: |
2,5-Furandione;cis-Butenedioic anhydride;Sodium n-amylxanthate;MaleicAnhydride;MA;furan-2,5-dione;Maleic acid anhydride; |
Molecular Structure: |
 |