Details for melting point standard benzophenone

melting point standard benzophenone
Category: |
Organic chemicals and Derivatives/Aldehyde and ketone compounds |
|
CAS NO: |
119-61-9 |
EC NO: |
204-337-6 |
Molecular Formula: |
C13H10O |
Molecular Weight: |
182.2179 |
Specification: |
|
InChI: |
InChI=1/C13H10O/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H |
Synonyms: |
Diphenyl ketone;Diphenylmethanone;melting point standard benzophenone;dipheneyl ketone;alpha-Oxodiphenylmethane;alpha-Oxoditane;Benzoylbenzene;Oxodiphenylmethane;Oxoditane;phenyl ketone;Benzophenones;Photoinitiator-BP; |
Molecular Structure: |
 |
if you are sourcing melting point standard benzophenone from China ,just feel free to inquire