Details for 4-Fluorocinnamic acid

4-Fluorocinnamic acid
Category: |
Organic chemicals and Derivatives/Acid, ester and anhydride compounds |
|
CAS NO: |
459-32-5 |
EC NO: |
207-288-9 |
Molecular Formula: |
C9H7FO2 |
Molecular Weight: |
166.1417 |
Specification: |
|
InChI: |
InChI=1/C9H7FO2/c10-8-4-1-7(2-5-8)3-6-9(11)12/h1-6H,(H,11,12)/p-1/b6-3+ |
Synonyms: |
3-(4-Fluoro-phenyl)-acrylic acid;p-Fluorocinnamic acid;4-Fluorophenyl acrylic acid;pent-4-ynoic acid;3-(4-fluorophenyl)prop-2-enoic acid;N-(fluoromethyl)-2-hydroxy-N,N-dimethylethanaminium chloride;(2E)-3-(4-fluorophenyl)prop-2-enoic acid;(2E)-3-(4-fluorophenyl)prop-2-enoate; |
Molecular Structure: |
 |
if you are sourcing 4-Fluorocinnamic acid from China ,just feel free to inquire