Details for Antioxidant 5057

Antioxidant 5057
| Category: |
Catalyst and Auxiliary |
|
| CAS NO: |
68411-46-1 |
| EC NO: |
270-128-1 |
| Molecular Formula: |
C20H27N |
| Molecular Weight: |
281.4351 |
| Specification: |
|
| InChI: |
InChI=1/C12H11N.C8H16/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-7(2)6-8(3,4)5/h1-10,13H;1,6H2,2-5H3 |
| Synonyms: |
N-phenylaniline - 2,4,4-trimethylpent-1-ene (1:1);Antioxidant 5057;Irganox 5057;Quantox-557;Alkyl diphenylamine;AN 5057;N-Phenylbenzenamine reactioin products with 2,4,4-trimethylpentene; |
| Molecular Structure: |
 |
if you are sourcing Antioxidant 5057 from China ,just feel free to inquire