Details for 2-Aminobenzoic acid ethyl ester

2-Aminobenzoic acid ethyl ester
Category: |
Organic chemicals and Derivatives/Acid, ester and anhydride compounds |
|
CAS NO: |
87-25-2 |
EC NO: |
201-735-1 |
Molecular Formula: |
C9H11NO2 |
Molecular Weight: |
165.1891 |
Specification: |
|
InChI: |
InChI=1/C9H11NO2/c1-2-12-9(11)7-5-3-4-6-8(7)10/h3-6H,2,10H2,1H3 |
Synonyms: |
Fema 2421;ethyl anthranilate;ethyl o-aminobenzoate;anthranilic acid ethyl ester;2-(ethoxycarbonyl)aniline;2-amino-benzoicaciethylester;2-carboethoxyaniline;2-Aminobenzoic acid ethyl ester;Ethyl-o-aminobenzoate; |
Molecular Structure: |
 |
if you are sourcing 2-Aminobenzoic acid ethyl ester from China ,just feel free to inquire