| Category: |
Intermediates |
|
| CAS NO: |
931-36-2 |
| EC NO: |
213-234-5 |
| Molecular Formula: |
C6H10N2 |
| Molecular Weight: |
110.157 |
| Specification: |
|
| InChI: |
InChI=1/C6H10N2/c1-3-6-7-4-5(2)8-6/h4H,3H2,1-2H3,(H,7,8) |
Product description:
Product name: |
2-Ethyl-4-methylimidazole |
| Molecular formula: |
C6H10N2 |
| Molecular weight: |
110.16 |
| Structural formula: |
 |
| CAS NO: |
931-36-2 |
| Technical Parameters: |
| specification |
in-house stardand |
| Appearance |
yellow transparent liquid |
| Boiling Point |
292℃ |
| Assay |
96.0% |
| water |
0.50% |
|
| Use: |
營t is used in epoxy resin bonding, coating, molding, sealing, dipping and composite materials, etc. |
| Packing: |
180kg/drum |
| Transportation & storage: |
營t should be stored in cool, dry and ventilative place. During transportation, please handle it with care to prevent its inner package from breakage. |
|
| Synonyms: |
2-Ethyl-4-methyl-1H-imidazole;2-Ethyl-4-methyl imidazole;2-ethyl-5-methyl-1H-imidazole;4-methyl-2-Ethylimidazole;EMI24;Curazol 2E4MZ;2E4MZ;Curezol-2E4MZ;EMI-70;Epicure-EMI-24;Imicure-EMI-24;Imidazole, 2-ethyl-4(or 5)-methyl-;LABOTEST-BB LTBB000689;TIMTEC-BB SBB004334;1H-Imidazole, 2-ethyl-4-methyl-;Imidazole, 2-ethyl-4-methyl-;2-ethyl-4-methyl-1h-imidazole;2-Ethyl-4-methyl-3H-imidazole;4-Methyl-2-ethyl-1H-imidazole; |
| Molecular Structure: |
 |