Details for Ethyl lactate

Ethyl lactate
Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
97-64-3 |
EC NO: |
202-598-0 |
Molecular Formula: |
C5H10O3 |
Molecular Weight: |
118.1311 |
Specification: |
98% 99% 99.5% |
InChI: |
InChI=1/C5H10O3/c1-3-8-5(7)4(2)6/h4,6H,3H2,1-2H3/t4-/m1/s1 |
Synonyms: |
Lactic acid ethyl ester;Propanoic acid, 2-hydroxy-, ethyl ester;ethyl 2-hydroxypropanoate;ethyl (2R)-2-hydroxypropanoate;Dl-Ethyl Lactate; |
Molecular Structure: |
 |
if you are sourcing Ethyl lactate from China ,just feel free to inquire