Details for Methyl(R)-lactate

Methyl(R)-lactate
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
17392-83-5 |
| EC NO: |
241-420-6 |
| Molecular Formula: |
C4H8O3 |
| Molecular Weight: |
104.1045 |
| Specification: |
99% 99.5% |
| InChI: |
InChI=1/C4H8O3/c1-3(5)4(6)7-2/h3,5H,1-2H3/t3-/m1/s1 |
| Synonyms: |
Methyl-(r)-lactate;methyl d-(+)-lactate;methyl d-lactate;d-(+)-lactic acid methyl ester;d-lactic acid methyl ester;(r)-(+)-methyl lactate;methyl (2R)-2-hydroxypropanoate;Methyl (R)-(+)-lactate;D-Methyl Lactate;methyl (R)-2-hydroxypropanoate; |
| Molecular Structure: |
 |
if you are sourcing Methyl(R)-lactate from China ,just feel free to inquire