Details for Ferulic Acid

Ferulic Acid
| Category: |
Soaps and Cosmetics |
|
| CAS NO: |
1135-24-6 |
| EC NO: |
214-490-0 |
| Molecular Formula: |
C10H9O4 |
| Molecular Weight: |
193.1766 |
| Specification: |
|
| InChI: |
InChI=1/C10H10O4/c1-14-9-6-7(2-4-8(9)11)3-5-10(12)13/h2-6,11H,1H3,(H,12,13)/p-1/b5-3+ |
| Synonyms: |
Ferulic acid;3-(4-Hydroxy-3-methoxyphenyl)acrylic acid;3-(4-hydroxy-3-methoxyphenyl)prop-2-enoic acid;(2E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoic acid;(2E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate; |
| Molecular Structure: |
 |
if you are sourcing Ferulic Acid from China ,just feel free to inquire