| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
6131-90-4 |
| EC NO: |
204-814-9 |
| Molecular Formula: |
C2H3O2Na·3(H2O) |
| Molecular Weight: |
136.08 |
| Specification: |
|
| InChI: |
InChI=1/C2H4O2.Na.3H2O/c1-2(3)4;;;;/h1H3,(H,3,4);;3*1H2/q;+1;;;/p-1 |
| Packing: |
50kg net small plastic woven bag, 22Mts/teu without pallet or 20Mts/teu with pallets. |
Product description:
Appearance:White or yellowish crystalline granules
Molecular Weight: 136.08
Purity(CH3COONa?3H20):≥98%
Purity(CH3COONa):≥58%
PH Value(1% Solution):7~9 |
| Uses: |
Sodium acetate is a kind of chemical raw material, widely used in printing and dyeing, medicine, chemical agent,commercial catalyst, assistant, compound, antisepsis and antistaling agent etc. |
| Synonyms: |
Acetic acid sodium salt trihydrate;Sodium acetate trihydate;Sodium Acetate, Trihydrate;Sodium acetate trihydrate;Sodium acetate,trihydrate;Trihydrate Sodium Acetate;Sodium Acetate trihyddrate; |
| Molecular Structure: |
 |