Details for 4-nitrophenyl ester

4-nitrophenyl ester
Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
1956-10-1 |
EC NO: |
|
Molecular Formula: |
C14H19NO4 |
Molecular Weight: |
265.305 |
Specification: |
99% |
InChI: |
InChI=1/C14H19NO4/c1-2-3-4-5-6-7-14(16)19-13-10-8-12(9-11-13)15(17)18/h8-11H,2-7H2,1H3 |
Packing: |
25kg/drum |
Uses: |
Intermediate of organic synthesis |
Synonyms: |
Caprylic acid 4-nitrophenyl ester~4-Nitrophenyl octanoate~Octanoic acid 4-nitrophenyl ester;4-Nitrophenyl octanoate;4-nitrophenyl ester; |
Molecular Structure: |
 |
if you are sourcing 4-nitrophenyl ester from China ,just feel free to inquire