Details for 5-Methyl-2-aminobenzoic acid

5-Methyl-2-aminobenzoic acid
Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
2941-78-8 |
EC NO: |
220-932-3 |
Molecular Formula: |
C8H8NO2 |
Molecular Weight: |
150.1552 |
Specification: |
98% |
InChI: |
InChI=1/C8H9NO2/c1-5-2-3-7(9)6(4-5)8(10)11/h2-4H,9H2,1H3,(H,10,11)/p-1 |
Packing: |
25kg/drum |
Uses: |
Intermediate of organic synthesis |
Synonyms: |
5-Methylanthranilic acid;6-Amino-m-toluic acid;2-amino-5-methylbenzoate;5-Methyl-2-aminobenzoic acid; |
Molecular Structure: |
 |
if you are sourcing 5-Methyl-2-aminobenzoic acid from China ,just feel free to inquire