Details for Dimethyl 3-aminophthalate

Dimethyl 3-aminophthalate
Category: |
Intermediates |
|
CAS NO: |
34529-06-1 |
EC NO: |
|
Molecular Formula: |
C10H11NO4 |
Molecular Weight: |
209.1986 |
Specification: |
98% |
InChI: |
InChI=1/C10H11NO4/c1-14-9(12)6-4-3-5-7(11)8(6)10(13)15-2/h3-5H,11H2,1-2H3 |
Packing: |
25kg/drum |
Uses: |
Intermediate of organic synthesis |
Synonyms: |
1,2-benzenedicarboxylic acid, 3-amino-, dimethyl ester;Dimethyl 3-aminophthalate;1,2-dimethyl 3-aminobenzene-1,2-dicarboxylate; |
Molecular Structure: |
 |
if you are sourcing Dimethyl 3-aminophthalate from China ,just feel free to inquire