Details for Methyl 3,5-Dinitrobenzoate

Methyl 3,5-Dinitrobenzoate
Category: |
Intermediates |
|
CAS NO: |
2702-58-1 |
EC NO: |
220-289-9 |
Molecular Formula: |
C8H6N2O6 |
Molecular Weight: |
226.143 |
Specification: |
99% |
InChI: |
InChI=1/C8H6N2O6/c1-16-8(11)5-2-6(9(12)13)4-7(3-5)10(14)15/h2-4H,1H3 |
Packing: |
25kg/drum |
Uses: |
Intermediate of organic synthesis |
Synonyms: |
NSC 7317;Benzoic acid, 3,5-dinitro-, methyl ester (8CI)(9CI) |
Molecular Structure: |
 |
if you are sourcing Methyl 3,5-Dinitrobenzoate from China ,just feel free to inquire