Details for Dipropylene glycol monoethyl ether

Dipropylene glycol monoethyl ether
| Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
15764-24-6 |
| EC NO: |
|
| Molecular Formula: |
C8H18O3 |
| Molecular Weight: |
162.2267 |
| Specification: |
|
| InChI: |
InChI=1/C8H18O3/c1-4-10-8(3)6-11-7(2)5-9/h7-9H,4-6H2,1-3H3 |
| Synonyms: |
1-Propanol, 2-(2-ethoxypropoxy)-;1-(2-ethoxy-2 methylethoxy)-2-propanol;1-(2-Ethoxy-2-methylethoxy)-2-propanol;2-(2-ethoxypropoxy)-1-propano;3-(3-ethoxypropoxy)propan-1-ol;2-(2-ethoxypropoxy)propan-1-ol;Dipropylene Glycol Monoethyl Ether; |
| Molecular Structure: |
 |
if you are sourcing Dipropylene glycol monoethyl ether from China ,just feel free to inquire