Details for 2-heptanone

2-heptanone
| Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
110-43-0 |
| EC NO: |
203-767-1 |
| Molecular Formula: |
C7H14O |
| Molecular Weight: |
114.1855 |
| Specification: |
|
| InChI: |
InChI=1/C7H14O/c1-3-4-5-6-7(2)8/h3-6H2,1-2H3 |
| Synonyms: |
Methyl amyl ketone;n-Amyl methyl ketone;Methyl n-pentyl ketone;1-Methylhexanal;2-Heptanal;2-Heptanon;2-Ketoheptane;2-Oxoheptane;Amyl-methyl-cetone;amyl-methyl-cetone(french);heptan-2-one;MAK; |
| Molecular Structure: |
 |
if you are sourcing 2-heptanone from China ,just feel free to inquire