Details for Ethyl 3-methylbutyrate

Ethyl 3-methylbutyrate
| Category: |
Organic chemicals and Derivatives/Acid, ester and anhydride compounds |
|
| CAS NO: |
108-64-5 |
| EC NO: |
203-602-3 |
| Molecular Formula: |
C7H14O2 |
| Molecular Weight: |
130.1849 |
| Specification: |
|
| InChI: |
InChI=1/C7H14O2/c1-4-9-7(8)5-6(2)3/h6H,4-5H2,1-3H3 |
| Synonyms: |
Ethyl isopentanoate;Isovaleric acid ethyl ester;Isovaleriansaeureethylester;Ethyl 3-methylbutyrate;3-Methylbutyric acid ethyl ester;ethyl 3-methylbutanoate; |
| Molecular Structure: |
 |
if you are sourcing Ethyl 3-methylbutyrate from China ,just feel free to inquire