Details for Isoamyl phenylacetate

Isoamyl phenylacetate
Category: |
Pharmaceuticals and Biochemicals |
|
CAS NO: |
102-19-2 |
EC NO: |
203-012-6 |
Molecular Formula: |
C13H18O2 |
Molecular Weight: |
206.2808 |
Specification: |
|
InChI: |
InChI=1/C13H18O2/c1-11(2)8-9-15-13(14)10-12-6-4-3-5-7-12/h3-7,11H,8-10H2,1-2H3 |
Synonyms: |
3-Methylbutyl benzeneacetate;3-Methylbutyl phenylacetate;AI3-36555;Acetic acid, phenyl-, isopentyl ester;BRN 1951778;FEMA No. 2081;Isoamyl alpha-toluate;Isoamyl phenylacetate;Isopentyl phenylacetate;Isopentylphenylacetate;NSC 60582;Phenylacetic acid, isopentyl ester;UNII-E5RHQ50DDC;Phenyl-acetic acid isopentyl ester; |
Molecular Structure: |
 |
if you are sourcing Isoamyl phenylacetate from China ,just feel free to inquire