Details for Natural Ethyl phenylacetate

Natural Ethyl phenylacetate
Category: |
Pharmaceuticals and Biochemicals |
|
CAS NO: |
101-97-3 |
EC NO: |
202-993-8 |
Molecular Formula: |
C10H12O2 |
Molecular Weight: |
164.2011 |
Specification: |
|
InChI: |
InChI=1/C10H12O2/c1-2-12-10(11)8-9-6-4-3-5-7-9/h3-7H,2,8H2,1H3 |
Synonyms: |
5-Fluoro-4-Hydroxy-2-Mercaptopyrimidine;Phenylacetic acid ethyl ester;Benzeneacetic acid, ethyl ester;Ethyl alpha-toluate;Ethyl phenacetate;Ethyl 2-phenylacetate; |
Molecular Structure: |
 |
if you are sourcing Natural Ethyl phenylacetate from China ,just feel free to inquire