Details for Natural trans-2-hexenoic acid

Natural trans-2-hexenoic acid
Category: |
Pharmaceuticals and Biochemicals |
|
CAS NO: |
1191-04-4 |
EC NO: |
236-528-5 |
Molecular Formula: |
C6H9O2 |
Molecular Weight: |
113.135 |
Specification: |
|
InChI: |
InChI=1/C6H10O2/c1-2-3-4-5-6(7)8/h4-5H,2-3H2,1H3,(H,7,8)/p-1/b5-4+ |
Synonyms: |
2-Hexenoic acid;trans-2-Hexenoic acid;(E)-2-Hexenoic acid;trans-2-Hexenoic acid;(2E)-hex-2-enoic acid;(2E)-hex-2-enoate;HEX-2(TRANS)-ENOIC ACID;ISOHYDROSORBIC ACID;TIMTEC-BB SBB009088;T-2-HEXENOIC ACID; |
Molecular Structure: |
 |
if you are sourcing Natural trans-2-hexenoic acid from China ,just feel free to inquire