| Category: |
Pharmaceuticals and Biochemicals/Vitamin, amino acids and coenzymes |
|
| CAS NO: |
640-68-6 |
| EC NO: |
211-368-9 |
| Molecular Formula: |
C5H11NO2 |
| Molecular Weight: |
117.1463 |
| Specification: |
|
| InChI: |
InChI=1/C5H11NO2/c1-3(2)4(6)5(7)8/h3-4H,6H2,1-2H3,(H,7,8)/t4-/m1/s1 |
Product description:
Appearance
White or off-white crystalline powder
Specific Rotation
(C=8??6N HCl)
-27.6 to -29.0°
Chloride (Cl)
not more than 0.02%
Loss on drying
≤0.2%
Residue on Ignition
not more than 0.1%
Heavy Metals(Pb)
not more than 10ppm
Assay
98.5 to 100.5%
|
| Synonyms: |
D-2-Amino-3-methylbutanoic acid;H-D-Val-OH; |
| Molecular Structure: |
 |