Details for H-beta-Ala-OEt.HCl

H-beta-Ala-OEt.HCl
| Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
4244-84-2 |
| EC NO: |
224-203-0 |
| Molecular Formula: |
C5H12NO2 |
| Molecular Weight: |
118.1537 |
| Specification: |
|
| InChI: |
InChI=1/C5H11NO2/c1-2-8-5(7)3-4-6/h2-4,6H2,1H3/p+1 |
Product description:
4244-84-2H-beta-Ala-OEt . HCl
Quick Details
ProName: H-beta-Ala-OEt . HCl CasNo: 4244-84-2 DeliveryTime: Inquiry PackAge: 5g/tin; 250g/tin; 1kg/tin Port: Shanghai ProductionCapacity: 100 Kilogram/Month Purity: 99% LimitNum: 0 Metric Ton |
| Synonyms: |
beta-Alanine ethyl ester HCl;H-ß-Ala-OEt.HCl;3-aminopropionic acid ethyl ester hydrochloride;beta-alanine-oet hcl;β-alanine ethyl ester hcl;β-alanine ethyl ester hydrochloride;H-BETA-ALA-OET HCL;ethyl 3-aminopropanoate hydrochloride;ethyl beta-alaninate;ethyl beta-alaninate hydrochloride (1:1);3-ethoxy-3-oxopropan-1-aminium;β-alanine ethyl ester HCL;H-β-Ala-OEt·HCl; |
| Molecular Structure: |
 |
if you are sourcing H-beta-Ala-OEt.HCl from China ,just feel free to inquire