Details for gamma-UNDECALACTONE

gamma-UNDECALACTONE
| Category: |
Organic chemicals and Derivatives/Aldehyde and ketone compounds |
|
| CAS NO: |
104-67-6 |
| EC NO: |
204-692-7 |
| Molecular Formula: |
C11H20O2 |
| Molecular Weight: |
184.2753 |
| Specification: |
|
| InChI: |
InChI=1/C11H20O2/c1-2-3-4-5-6-7-10-8-9-11(12)13-10/h10H,2-9H2,1H3/t10-/m0/s1 |
| Synonyms: |
GAMMA.-Undecalactone;Gamma-Undecalactone;-Heptyldihydro-furanone;gamma-Undecanolactone;4-n-Heptyl-4-hydroxybutanoic acid lactone;Undecan-4-olide;tetradecyl aldehyde;myristaldehyde;Aldehyde C14;Aldehyde C-14 myristic;tetradecanal;PEACH ALDEHYDE;Aldehdye c14;5-heptyldihydrofuran-2(3H)-one;(5S)-5-heptyldihydrofuran-2(3H)-one;Fema 2763;n-Tetradecanal; |
| Molecular Structure: |
 |
if you are sourcing gamma-UNDECALACTONE from China ,just feel free to inquire