Details for 3-Bromobenzoic acid

3-Bromobenzoic acid
| Category: |
Intermediates |
|
| CAS NO: |
585-76-2 |
| EC NO: |
209-562-3 |
| Molecular Formula: |
C7H4BrO2 |
| Molecular Weight: |
200.01 |
| Specification: |
|
| InChI: |
InChI=1/C7H5BrO2/c8-6-3-1-2-5(4-6)7(9)10/h1-4H,(H,9,10)/p-1 |
| Synonyms: |
Brombenzoicacid;3-Brom-benzoic acid;M-BROMOBENZOIC ACID;M-CARBOXYBENZYL BROMIDE;3-BROMBENZOIC ACID;RARECHEM AL BO 0037;3-bromo-benzoicaci;Benzoic acid, m-bromo-;Benzoicacid,3-bromo-;3-bromobenzoate; |
| Molecular Structure: |
 |
if you are sourcing 3-Bromobenzoic acid from China ,just feel free to inquire