Details for 4-Biphenylboronic acid

4-Biphenylboronic acid
| Category: |
Organic chemicals and Derivatives/Aroma compounds |
|
| CAS NO: |
5122-94-1 |
| EC NO: |
|
| Molecular Formula: |
C12H11BO2 |
| Molecular Weight: |
198.0255 |
| Specification: |
|
| InChI: |
InChI=1/C12H11BO2/c14-13(15)12-8-6-11(7-9-12)10-4-2-1-3-5-10/h1-9,14-15H |
| Synonyms: |
(1,1-Biphenyl-4-yl)boronic acid;4-Phenylbenzeneboronic acid;[1,1-Biphenyl]-4-ylboronic acid;[1,1'-Biphenyl]-4-ylboronic acid;biphenyl-4-ylboronic acid;RARECHEM AH PB 0261;(1,1'-BIPHENYL-4-YL)BORONIC ACID;4-Diphenylboronicacid; |
| Molecular Structure: |
 |
if you are sourcing 4-Biphenylboronic acid from China ,just feel free to inquire