Details for m-Tolylboronic acid

m-Tolylboronic acid
| Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
17933-03-8 |
| EC NO: |
|
| Molecular Formula: |
C7H9BO2 |
| Molecular Weight: |
135.9562 |
| Specification: |
|
| InChI: |
InChI=1/C7H9BO2/c1-6-3-2-4-7(5-6)8(9)10/h2-5,9-10H,1H3 |
| Synonyms: |
m-Tolylboronic acid;3-methylbenzeneboronic acid;(3-methylphenyl)boronic acid;3-Methylphenylboric acid;3-METHYLPHENYLBORONIC ACID;3-Methyl Phenyl Boronic Acid;3-Methylphenyl boronic acid: |
| Molecular Structure: |
 |
if you are sourcing m-Tolylboronic acid from China ,just feel free to inquire