Details for Lithium triethylborohydride

Lithium triethylborohydride
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
22560-16-3 |
| EC NO: |
245-076-8 |
| Molecular Formula: |
C6H16BLi |
| Molecular Weight: |
105.9432 |
| Specification: |
|
| InChI: |
InChI=1/C6H16B.Li/c1-4-7(5-2)6-3;/h7H,4-6H2,1-3H3;/q-1;+1 |
| Synonyms: |
Lithium triethylhydroborate;super-hydride lithium triethylboro-hydride;lithium triethyl(hydrido)borate(1-);super-hydride;Lithium borohydride thiethyl;three ethyl borohydride;
|
| Molecular Structure: |
 |
if you are sourcing Lithium triethylborohydride from China ,just feel free to inquire