Details for Dipropylene glycol butyl ether

Dipropylene glycol butyl ether
Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
35884-42-5 |
EC NO: |
252-776-7 |
Molecular Formula: |
C10H22O3 |
Molecular Weight: |
190.2799 |
Specification: |
|
InChI: |
InChI=1/C10H22O3/c1-3-5-7-12-8-6-9-13-10(11)4-2/h10-11H,3-9H2,1-2H3 |
Synonyms: |
Di(propylene glycol) butyl ether,mixture of isomers;1-(3-butoxypropoxy)propan-1-ol;Dipropylene glycol butyl ether; |
Molecular Structure: |
 |
if you are sourcing Dipropylene glycol butyl ether from China ,just feel free to inquire