Details for 4'-Hydroxyacetophenone

4'-Hydroxyacetophenone
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
99-93-4 |
| EC NO: |
202-802-8 |
| Molecular Formula: |
C8H8O2 |
| Molecular Weight: |
136.1479 |
| Specification: |
|
| InChI: |
InChI=1/C8H8O2/c1-6(9)7-2-4-8(10)5-3-7/h2-5,10H,1H3 |
| Synonyms: |
4-Acetylphenol;4-Hydroxyacetophenone;1-(4-Hydroxyphenyl)ethanone;P-Hydroxyacetophenone;p-Acetylphenol;4-hydroxyphenyl methyl ketone; |
| Molecular Structure: |
 |
if you are sourcing 4'-Hydroxyacetophenone from China ,just feel free to inquire