Details for Ethyl ferulate

Ethyl ferulate
| Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
4046-02-0 |
| EC NO: |
223-745-5 |
| Molecular Formula: |
C12H14O4 |
| Molecular Weight: |
222.2372 |
| Specification: |
|
| InChI: |
InChI=1/C12H14O4/c1-3-16-12(14)7-5-9-4-6-10(13)11(8-9)15-2/h4-8,13H,3H2,1-2H3/b7-5+ |
| Synonyms: |
Ethyl ferulate~Ferulic acid ethyl ester~4-Hydroxy-3-methoxycinnamic acid ethyl ester;Ethyl Ferulate;Ferulic Acid Ethylester;ethyl 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate;ethyl (2E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate;Ethyl 4'-hydroxy-3'-methoxycinnamate;Ethyl ferulate;2-Propenoic acid, 3-(4-hydroxy-3-methoxyphenyl)-, ethyl ester;UNII-5B8915UELW;AI3-23714;Ethyl 3-(4-hydroxy-3-methoxyphenyl)acrylate; |
| Molecular Structure: |
 |
if you are sourcing Ethyl ferulate from China ,just feel free to inquire