Details for Solvent Red 52

Solvent Red 52
| Category: |
Dyestuffs and Pigments |
|
| CAS NO: |
81-39-0 |
| EC NO: |
201-346-7 |
| Molecular Formula: |
C24H18N2O2 |
| Molecular Weight: |
366.4119 |
| Specification: |
|
| InChI: |
InChI=1/C24H18N2O2/c1-14-7-9-15(10-8-14)25-19-11-12-20-22-18(13-21(27)26(20)2)16-5-3-4-6-17(16)24(28)23(19)22/h3-13,25H,1-2H3 |
| Synonyms: |
C.I.Solvent Red 52;Solvent Red 52;Red H5B;3-methyl-6-[(4-methylphenyl)amino]-3H-naphtho[1,2,3-de]quinoline-2,7-dione;Plast red 3007; |
| Molecular Structure: |
 |
if you are sourcing Solvent Red 52 from China ,just feel free to inquire