Details for 4-Chloro-3-Nitrotoluene

4-Chloro-3-Nitrotoluene
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
89-60-1 |
| EC NO: |
201-922-8 |
| Molecular Formula: |
C7H6ClNO2 |
| Molecular Weight: |
171.581 |
| Specification: |
|
| InChI: |
InChI=1/C7H6ClNO2/c1-5-2-3-6(8)7(4-5)9(10)11/h2-4H,1H3 |
| Synonyms: |
Benzene, 1-chloro-4-methyl-2-nitro-;1-Chloro-4-methyl-2-nitrobenzene;2-Chloro-5-methylnitrobenzene;3-Nitro-4-chlorotoluene;NSC 60721;Toluene, 4-chloro-3-nitro- (8CI) |
| Molecular Structure: |
 |
if you are sourcing 4-Chloro-3-Nitrotoluene from United-States ,just feel free to inquire