Details for 5-Chloro-2-nitrotoluene

5-Chloro-2-nitrotoluene
| Category: |
Organic chemicals and Derivatives/Aliphatic compounds |
|
| CAS NO: |
5367-28-2 |
| EC NO: |
226-355-3 |
| Molecular Formula: |
C7H6ClNO2 |
| Molecular Weight: |
171.581 |
| Specification: |
|
| InChI: |
InChI=1/C7H6ClNO2/c1-5-4-6(8)2-3-7(5)9(10)11/h2-4H,1H3 |
| Synonyms: |
Benzene, 1-chloro-3-methyl-4-nitro- (9CI);4-05-00-00854 (Beilstein Handbook Reference);BRN 2502585;3-Chloro-6-nitrotoluene;Toluene, 5-chloro-2-nitro-;4-chloro-2-methyl-1-nitrobenzene; |
| Molecular Structure: |
 |
if you are sourcing 5-Chloro-2-nitrotoluene from United-States ,just feel free to inquire