Details for Pyronin Y

Pyronin Y
| Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
92-32-0 |
| EC NO: |
202-147-8 |
| Molecular Formula: |
C17H19ClN2O |
| Molecular Weight: |
302.7986 |
| Specification: |
|
| InChI: |
InChI=1/C17H19N2O.ClH/c1-18(2)14-7-5-12-9-13-6-8-15(19(3)4)11-17(13)20-16(12)10-14;/h5-11H,1-4H3;1H/q+1;/p-1 |
| Synonyms: |
C.I. 45005;Pyronine;Pyronin G;PYRONINE G;pyronin Y molecular biology;Pyronin Y, CI 45005;Pyronine Y;N-[6-(dimethylamino)-3H-xanthen-3-ylidene]-N-methylmethanaminium chloride; |
| Molecular Structure: |
 |
if you are sourcing Pyronin Y from Germany ,just feel free to inquire