Details for α-Methyl-β-hydroxypropyl-α-Methyl-β-Mercapto propyl sulfide

α-Methyl-β-hydroxypropyl-α-Methyl-β-Mercapto propyl sulfide
| Category: |
Fragrances and Aroma chemicals |
|
| CAS NO: |
54957-02-7 |
| EC NO: |
|
| Molecular Formula: |
C8H18OS2 |
| Molecular Weight: |
194.3579 |
| Specification: |
|
| InChI: |
InChI=1/C8H18OS2/c1-5(9)7(3)11-8(4)6(2)10/h5-10H,1-4H3 |
| Synonyms: |
2-Butanol, 3-((2-mercapto-1-methylpropyl)thio)-;FEMA No. 3509;alpha-Methyl-beta-hydroxypropyl alpha-methyl-beta-mercaptopropyl sulfide;3-((2-Mercapto-1-methylpropyl)thio)-2-butanol;3-[(3-sulfanylbutan-2-yl)sulfanyl]butan-2-ol;α-Methyl-β-mercapto propyl α'-methyl-β'-hydroxyl propyl sulfide;α-Methyl-β-hydroxypropyl-α-Methyl-β-Mercapto propyl sulfide; |
| Molecular Structure: |
 |
if you are sourcing α-Methyl-β-hydroxypropyl-α-Methyl-β-Mercapto propyl sulfide from China ,just feel free to inquire